C10H17N — CID 174042590
(1Z,3E)-6-ethylocta-1,3,7-trien-1-amine (PubChem CID 174042590) has the molecular formula C10H17N and a molecular weight of 151.25 g/mol. Its IUPAC name is (1Z,3E)-6-ethylocta-1,3,7-trien-1-amine.
| Compound Name | (1Z,3E)-6-ethylocta-1,3,7-trien-1-amine |
|---|---|
| PubChem CID | 174042590 |
| Molecular Formula | C10H17N |
| Molecular Weight | 151.25 g/mol |
| Exact Mass | 151.14 |
| IUPAC Name | (1Z,3E)-6-ethylocta-1,3,7-trien-1-amine |
| SMILES | C=CC(CC)C/C=C/C=C\N |
| InChI | InChI=1S/C10H17N/c1-3-10(4-2)8-6-5-7-9-11/h3,5-7,9-10H,1,4,8,11H2,2H3/b6-5+,9-7- |
| InChIKey | GPUMTCOWNOXUJP-UQIVLYAPSA-N |
| XLogP | 2.62 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 151.25 |
| LogP ≤ 5 | 2.62 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|