C12H20 — CID 22448221
(5E)-3-ethyl-7-methylidenenona-1,5-diene (PubChem CID 22448221) has the molecular formula C12H20 and a molecular weight of 164.29 g/mol. Its IUPAC name is (5E)-3-ethyl-7-methylidenenona-1,5-diene.
| Compound Name | (5E)-3-ethyl-7-methylidenenona-1,5-diene |
|---|---|
| PubChem CID | 22448221 |
| Molecular Formula | C12H20 |
| Molecular Weight | 164.29 g/mol |
| Exact Mass | 164.16 |
| IUPAC Name | (5E)-3-ethyl-7-methylidenenona-1,5-diene |
| SMILES | C=CC(CC)C/C=C/C(=C)CC |
| InChI | InChI=1S/C12H20/c1-5-11(4)9-8-10-12(6-2)7-3/h6,8-9,12H,2,4-5,7,10H2,1,3H3/b9-8+ |
| InChIKey | GWAGXFLSHWZHSA-CMDGGOBGSA-N |
| XLogP | 4.11 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 6 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 164.29 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|