About 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal
2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal (PubChem CID 87301215) has the molecular formula C11H18O2S
and a molecular weight of 214.33 g/mol. Its IUPAC name is 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal.
Molecular Properties
| Compound Name | 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal |
| PubChem CID | 87301215 |
| Molecular Formula | C11H18O2S |
| Molecular Weight | 214.33 g/mol |
| Exact Mass | 214.10 |
| IUPAC Name | 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal |
| SMILES | C=C(C=O)CC.CCC(C=O)CC=S |
| InChI | InChI=1S/C6H10OS.C5H8O/c1-2-6(5-7)3-4-8;1-3-5(2)4-6/h4-6H,2-3H2,1H3;4H,2-3H2,1H3 |
| InChIKey | OXUPDDNMIWGOKI-UHFFFAOYSA-N |
| XLogP | 2.75 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 14 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 214.33 |
| LogP ≤ 5 | 2.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal?
The IUPAC name of 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal (CID 87301215) is 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal.
What is the SMILES notation for 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal?
The canonical SMILES for 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal is C=C(C=O)CC.CCC(C=O)CC=S.
What is the InChIKey of 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal?
The InChIKey is OXUPDDNMIWGOKI-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H10OS.C5H8O/c1-2-6(5-7)3-4-8;1-3-5(2)4-6/h4-6H,2-3H2,1H3;4H,2-3H2,1H3.
What are the key properties of 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal?
2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal has a molecular weight of 214.33 g/mol, XLogP of 2.75, 6 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-ethyl-4-sulfanylidenebutanal;2-methylidenebutanal is sourced from PubChem (CID 87301215), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).