About 2-methylpropanethial;2-sulfanylbutanal
2-methylpropanethial;2-sulfanylbutanal (PubChem CID 174715892) has the molecular formula C8H16OS2
and a molecular weight of 192.35 g/mol. Its IUPAC name is 2-methylpropanethial;2-sulfanylbutanal.
Molecular Properties
| Compound Name | 2-methylpropanethial;2-sulfanylbutanal |
| PubChem CID | 174715892 |
| Molecular Formula | C8H16OS2 |
| Molecular Weight | 192.35 g/mol |
| Exact Mass | 192.06 |
| IUPAC Name | 2-methylpropanethial;2-sulfanylbutanal |
| SMILES | CC(C)C=S.CCC(S)C=O |
| InChI | InChI=1S/C4H8OS.C4H8S/c1-2-4(6)3-5;1-4(2)3-5/h3-4,6H,2H2,1H3;3-4H,1-2H3 |
| InChIKey | AOXBKPHOQRHXQM-UHFFFAOYSA-N |
| XLogP | 2.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 11 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 192.35 |
| LogP ≤ 5 | 2.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thio_aldehyd_A(3)', 'substructure': 'N/A'}, {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanethial;2-sulfanylbutanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanethial;2-sulfanylbutanal?
The IUPAC name of 2-methylpropanethial;2-sulfanylbutanal (CID 174715892) is 2-methylpropanethial;2-sulfanylbutanal.
What is the SMILES notation for 2-methylpropanethial;2-sulfanylbutanal?
The canonical SMILES for 2-methylpropanethial;2-sulfanylbutanal is CC(C)C=S.CCC(S)C=O.
What is the InChIKey of 2-methylpropanethial;2-sulfanylbutanal?
The InChIKey is AOXBKPHOQRHXQM-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8OS.C4H8S/c1-2-4(6)3-5;1-4(2)3-5/h3-4,6H,2H2,1H3;3-4H,1-2H3.
What are the key properties of 2-methylpropanethial;2-sulfanylbutanal?
2-methylpropanethial;2-sulfanylbutanal has a molecular weight of 192.35 g/mol, XLogP of 2.54, 3 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanethial;2-sulfanylbutanal is sourced from PubChem (CID 174715892), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).