About hydride;2-methylpropanal;rubidium(1+)
hydride;2-methylpropanal;rubidium(1+) (PubChem CID 173100636) has the molecular formula C4H9ORb
and a molecular weight of 158.58 g/mol. Its IUPAC name is hydride;2-methylpropanal;rubidium(1+).
Molecular Properties
| Compound Name | hydride;2-methylpropanal;rubidium(1+) |
| PubChem CID | 173100636 |
| Molecular Formula | C4H9ORb |
| Molecular Weight | 158.58 g/mol |
| Exact Mass | 157.98 |
| IUPAC Name | hydride;2-methylpropanal;rubidium(1+) |
| SMILES | CC(C)C=O.[H-].[Rb+] |
| InChI | InChI=1S/C4H8O.Rb.H/c1-4(2)3-5;;/h3-4H,1-2H3;;/q;+1;-1 |
| InChIKey | VDOJDOKLNNEDEG-UHFFFAOYSA-N |
| XLogP | -2.04 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 158.58 |
| LogP ≤ 5 | -2.04 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze hydride;2-methylpropanal;rubidium(1+) with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hydride;2-methylpropanal;rubidium(1+)?
The IUPAC name of hydride;2-methylpropanal;rubidium(1+) (CID 173100636) is hydride;2-methylpropanal;rubidium(1+).
What is the SMILES notation for hydride;2-methylpropanal;rubidium(1+)?
The canonical SMILES for hydride;2-methylpropanal;rubidium(1+) is CC(C)C=O.[H-].[Rb+].
What is the InChIKey of hydride;2-methylpropanal;rubidium(1+)?
The InChIKey is VDOJDOKLNNEDEG-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.Rb.H/c1-4(2)3-5;;/h3-4H,1-2H3;;/q;+1;-1.
What are the key properties of hydride;2-methylpropanal;rubidium(1+)?
hydride;2-methylpropanal;rubidium(1+) has a molecular weight of 158.58 g/mol, XLogP of -2.04, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for hydride;2-methylpropanal;rubidium(1+) is sourced from PubChem (CID 173100636), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).