About acetonitrile;2-methylpropanal
acetonitrile;2-methylpropanal (PubChem CID 174939859) has the molecular formula C6H11NO
and a molecular weight of 113.16 g/mol. Its IUPAC name is acetonitrile;2-methylpropanal.
Molecular Properties
| Compound Name | acetonitrile;2-methylpropanal |
| PubChem CID | 174939859 |
| Molecular Formula | C6H11NO |
| Molecular Weight | 113.16 g/mol |
| Exact Mass | 113.08 |
| IUPAC Name | acetonitrile;2-methylpropanal |
| SMILES | CC#N.CC(C)C=O |
| InChI | InChI=1S/C4H8O.C2H3N/c1-4(2)3-5;1-2-3/h3-4H,1-2H3;1H3 |
| InChIKey | HSTHJUGWFHJSBQ-UHFFFAOYSA-N |
| XLogP | 1.37 |
| TPSA | 40.86 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 113.16 |
| LogP ≤ 5 | 1.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetonitrile;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetonitrile;2-methylpropanal?
The IUPAC name of acetonitrile;2-methylpropanal (CID 174939859) is acetonitrile;2-methylpropanal.
What is the SMILES notation for acetonitrile;2-methylpropanal?
The canonical SMILES for acetonitrile;2-methylpropanal is CC#N.CC(C)C=O.
What is the InChIKey of acetonitrile;2-methylpropanal?
The InChIKey is HSTHJUGWFHJSBQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.C2H3N/c1-4(2)3-5;1-2-3/h3-4H,1-2H3;1H3.
What are the key properties of acetonitrile;2-methylpropanal?
acetonitrile;2-methylpropanal has a molecular weight of 113.16 g/mol, XLogP of 1.37, 1 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetonitrile;2-methylpropanal is sourced from PubChem (CID 174939859), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).