About acetaldehyde;cyanic acid;2-methylpropane
acetaldehyde;cyanic acid;2-methylpropane (PubChem CID 142596077) has the molecular formula C7H15NO2
and a molecular weight of 145.20 g/mol. Its IUPAC name is acetaldehyde;cyanic acid;2-methylpropane.
Molecular Properties
| Compound Name | acetaldehyde;cyanic acid;2-methylpropane |
| PubChem CID | 142596077 |
| Molecular Formula | C7H15NO2 |
| Molecular Weight | 145.20 g/mol |
| Exact Mass | 145.11 |
| IUPAC Name | acetaldehyde;cyanic acid;2-methylpropane |
| SMILES | CC(C)C.CC=O.N#CO |
| InChI | InChI=1S/C4H10.C2H4O.CHNO/c1-4(2)3;1-2-3;2-1-3/h4H,1-3H3;2H,1H3;3H |
| InChIKey | SRSWIVYZSGNUMY-UHFFFAOYSA-N |
| XLogP | 1.71 |
| TPSA | 61.09 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 145.20 |
| LogP ≤ 5 | 1.71 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'cyanate_/aminonitrile_/thiocyanate', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;cyanic acid;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;cyanic acid;2-methylpropane?
The IUPAC name of acetaldehyde;cyanic acid;2-methylpropane (CID 142596077) is acetaldehyde;cyanic acid;2-methylpropane.
What is the SMILES notation for acetaldehyde;cyanic acid;2-methylpropane?
The canonical SMILES for acetaldehyde;cyanic acid;2-methylpropane is CC(C)C.CC=O.N#CO.
What is the InChIKey of acetaldehyde;cyanic acid;2-methylpropane?
The InChIKey is SRSWIVYZSGNUMY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C2H4O.CHNO/c1-4(2)3;1-2-3;2-1-3/h4H,1-3H3;2H,1H3;3H.
What are the key properties of acetaldehyde;cyanic acid;2-methylpropane?
acetaldehyde;cyanic acid;2-methylpropane has a molecular weight of 145.20 g/mol, XLogP of 1.71, 0 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;cyanic acid;2-methylpropane is sourced from PubChem (CID 142596077), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).