About acetaldehyde;formaldehyde;2-methylpropane
acetaldehyde;formaldehyde;2-methylpropane (PubChem CID 157456500) has the molecular formula C7H16O2
and a molecular weight of 132.20 g/mol. Its IUPAC name is acetaldehyde;formaldehyde;2-methylpropane.
Molecular Properties
| Compound Name | acetaldehyde;formaldehyde;2-methylpropane |
| PubChem CID | 157456500 |
| Molecular Formula | C7H16O2 |
| Molecular Weight | 132.20 g/mol |
| Exact Mass | 132.12 |
| IUPAC Name | acetaldehyde;formaldehyde;2-methylpropane |
| SMILES | C=O.CC(C)C.CC=O |
| InChI | InChI=1S/C4H10.C2H4O.CH2O/c1-4(2)3;1-2-3;1-2/h4H,1-3H3;2H,1H3;1H2 |
| InChIKey | BTKLAKKTUBMKMV-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 34.14 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 132.20 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze acetaldehyde;formaldehyde;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of acetaldehyde;formaldehyde;2-methylpropane?
The IUPAC name of acetaldehyde;formaldehyde;2-methylpropane (CID 157456500) is acetaldehyde;formaldehyde;2-methylpropane.
What is the SMILES notation for acetaldehyde;formaldehyde;2-methylpropane?
The canonical SMILES for acetaldehyde;formaldehyde;2-methylpropane is C=O.CC(C)C.CC=O.
What is the InChIKey of acetaldehyde;formaldehyde;2-methylpropane?
The InChIKey is BTKLAKKTUBMKMV-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C2H4O.CH2O/c1-4(2)3;1-2-3;1-2/h4H,1-3H3;2H,1H3;1H2.
What are the key properties of acetaldehyde;formaldehyde;2-methylpropane?
acetaldehyde;formaldehyde;2-methylpropane has a molecular weight of 132.20 g/mol, XLogP of 1.68, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for acetaldehyde;formaldehyde;2-methylpropane is sourced from PubChem (CID 157456500), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).