About formaldehyde;2-methylpropane
formaldehyde;2-methylpropane (PubChem CID 157396277) has the molecular formula C5H12O
and a molecular weight of 88.15 g/mol. Its IUPAC name is formaldehyde;2-methylpropane.
Molecular Properties
| Compound Name | formaldehyde;2-methylpropane |
| PubChem CID | 157396277 |
| Molecular Formula | C5H12O |
| Molecular Weight | 88.15 g/mol |
| Exact Mass | 88.09 |
| IUPAC Name | formaldehyde;2-methylpropane |
| SMILES | C=O.CC(C)C |
| InChI | InChI=1S/C4H10.CH2O/c1-4(2)3;1-2/h4H,1-3H3;1H2 |
| InChIKey | BMPKBZXSDATYJY-UHFFFAOYSA-N |
| XLogP | 1.48 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 88.15 |
| LogP ≤ 5 | 1.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze formaldehyde;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-methylpropane?
The IUPAC name of formaldehyde;2-methylpropane (CID 157396277) is formaldehyde;2-methylpropane.
What is the SMILES notation for formaldehyde;2-methylpropane?
The canonical SMILES for formaldehyde;2-methylpropane is C=O.CC(C)C.
What is the InChIKey of formaldehyde;2-methylpropane?
The InChIKey is BMPKBZXSDATYJY-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.CH2O/c1-4(2)3;1-2/h4H,1-3H3;1H2.
What are the key properties of formaldehyde;2-methylpropane?
formaldehyde;2-methylpropane has a molecular weight of 88.15 g/mol, XLogP of 1.48, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-methylpropane is sourced from PubChem (CID 157396277), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).