About chromium;2-methylpropane
chromium;2-methylpropane (PubChem CID 160648898) has the molecular formula C4H10Cr
and a molecular weight of 110.12 g/mol. Its IUPAC name is chromium;2-methylpropane.
Molecular Properties
| Compound Name | chromium;2-methylpropane |
| PubChem CID | 160648898 |
| Molecular Formula | C4H10Cr |
| Molecular Weight | 110.12 g/mol |
| Exact Mass | 110.02 |
| IUPAC Name | chromium;2-methylpropane |
| SMILES | CC(C)C.[Cr] |
| InChI | InChI=1S/C4H10.Cr/c1-4(2)3;/h4H,1-3H3; |
| InChIKey | RKDSFGRHEOVFDB-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 110.12 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze chromium;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chromium;2-methylpropane?
The IUPAC name of chromium;2-methylpropane (CID 160648898) is chromium;2-methylpropane.
What is the SMILES notation for chromium;2-methylpropane?
The canonical SMILES for chromium;2-methylpropane is CC(C)C.[Cr].
What is the InChIKey of chromium;2-methylpropane?
The InChIKey is RKDSFGRHEOVFDB-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.Cr/c1-4(2)3;/h4H,1-3H3;.
What are the key properties of chromium;2-methylpropane?
chromium;2-methylpropane has a molecular weight of 110.12 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for chromium;2-methylpropane is sourced from PubChem (CID 160648898), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).