About mercury(1+);2-methylpropane;iodide
mercury(1+);2-methylpropane;iodide (PubChem CID 171374754) has the molecular formula C4H10HgI
and a molecular weight of 385.62 g/mol. Its IUPAC name is mercury(1+);2-methylpropane;iodide.
Molecular Properties
| Compound Name | mercury(1+);2-methylpropane;iodide |
| PubChem CID | 171374754 |
| Molecular Formula | C4H10HgI |
| Molecular Weight | 385.62 g/mol |
| Exact Mass | 386.95 |
| IUPAC Name | mercury(1+);2-methylpropane;iodide |
| SMILES | CC(C)C.[Hg+].[I-] |
| InChI | InChI=1S/C4H10.Hg.HI/c1-4(2)3;;/h4H,1-3H3;;1H/q;+1;/p-1 |
| InChIKey | FDJSCMKPNHGYJJ-UHFFFAOYSA-M |
| XLogP | -1.34 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 385.62 |
| LogP ≤ 5 | -1.34 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|
Analyze mercury(1+);2-methylpropane;iodide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of mercury(1+);2-methylpropane;iodide?
The IUPAC name of mercury(1+);2-methylpropane;iodide (CID 171374754) is mercury(1+);2-methylpropane;iodide.
What is the SMILES notation for mercury(1+);2-methylpropane;iodide?
The canonical SMILES for mercury(1+);2-methylpropane;iodide is CC(C)C.[Hg+].[I-].
What is the InChIKey of mercury(1+);2-methylpropane;iodide?
The InChIKey is FDJSCMKPNHGYJJ-UHFFFAOYSA-M. The full InChI is InChI=1S/C4H10.Hg.HI/c1-4(2)3;;/h4H,1-3H3;;1H/q;+1;/p-1.
What are the key properties of mercury(1+);2-methylpropane;iodide?
mercury(1+);2-methylpropane;iodide has a molecular weight of 385.62 g/mol, XLogP of -1.34, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for mercury(1+);2-methylpropane;iodide is sourced from PubChem (CID 171374754), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).