About argon;2-methylpropane
argon;2-methylpropane (PubChem CID 158681333) has the molecular formula C4H10Ar11
and a molecular weight of 497.55 g/mol. Its IUPAC name is argon;2-methylpropane.
Molecular Properties
| Compound Name | argon;2-methylpropane |
| PubChem CID | 158681333 |
| Molecular Formula | C4H10Ar11 |
| Molecular Weight | 497.55 g/mol |
| Exact Mass | 497.66 |
| IUPAC Name | argon;2-methylpropane |
| SMILES | CC(C)C.[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar] |
| InChI | InChI=1S/C4H10.11Ar/c1-4(2)3;;;;;;;;;;;/h4H,1-3H3;;;;;;;;;;; |
| InChIKey | IFDYWDYBGLEZNI-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 497.55 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze argon;2-methylpropane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of argon;2-methylpropane?
The IUPAC name of argon;2-methylpropane (CID 158681333) is argon;2-methylpropane.
What is the SMILES notation for argon;2-methylpropane?
The canonical SMILES for argon;2-methylpropane is CC(C)C.[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].[Ar].
What is the InChIKey of argon;2-methylpropane?
The InChIKey is IFDYWDYBGLEZNI-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.11Ar/c1-4(2)3;;;;;;;;;;;/h4H,1-3H3;;;;;;;;;;;.
What are the key properties of argon;2-methylpropane?
argon;2-methylpropane has a molecular weight of 497.55 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for argon;2-methylpropane is sourced from PubChem (CID 158681333), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).