About 2-methylpropane;sulfane
2-methylpropane;sulfane (PubChem CID 20976886) has the molecular formula C4H26S8
and a molecular weight of 330.79 g/mol. Its IUPAC name is 2-methylpropane;sulfane.
Molecular Properties
| Compound Name | 2-methylpropane;sulfane |
| PubChem CID | 20976886 |
| Molecular Formula | C4H26S8 |
| Molecular Weight | 330.79 g/mol |
| Exact Mass | 329.98 |
| IUPAC Name | 2-methylpropane;sulfane |
| SMILES | CC(C)C.S.S.S.S.S.S.S.S |
| InChI | InChI=1S/C4H10.8H2S/c1-4(2)3;;;;;;;;/h4H,1-3H3;8*1H2 |
| InChIKey | VQRUYHQTRFCEQZ-UHFFFAOYSA-N |
| XLogP | 2.56 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 330.79 |
| LogP ≤ 5 | 2.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylpropane;sulfane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;sulfane?
The IUPAC name of 2-methylpropane;sulfane (CID 20976886) is 2-methylpropane;sulfane.
What is the SMILES notation for 2-methylpropane;sulfane?
The canonical SMILES for 2-methylpropane;sulfane is CC(C)C.S.S.S.S.S.S.S.S.
What is the InChIKey of 2-methylpropane;sulfane?
The InChIKey is VQRUYHQTRFCEQZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.8H2S/c1-4(2)3;;;;;;;;/h4H,1-3H3;8*1H2.
What are the key properties of 2-methylpropane;sulfane?
2-methylpropane;sulfane has a molecular weight of 330.79 g/mol, XLogP of 2.56, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;sulfane is sourced from PubChem (CID 20976886), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).