About 2-methylpropane;tungsten
2-methylpropane;tungsten (PubChem CID 144526928) has the molecular formula C4H10W
and a molecular weight of 241.96 g/mol. Its IUPAC name is 2-methylpropane;tungsten.
Molecular Properties
| Compound Name | 2-methylpropane;tungsten |
| PubChem CID | 144526928 |
| Molecular Formula | C4H10W |
| Molecular Weight | 241.96 g/mol |
| Exact Mass | 242.03 |
| IUPAC Name | 2-methylpropane;tungsten |
| SMILES | CC(C)C.[W] |
| InChI | InChI=1S/C4H10.W/c1-4(2)3;/h4H,1-3H3; |
| InChIKey | HQLHPADIHSKCHQ-UHFFFAOYSA-N |
| XLogP | 1.66 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 241.96 |
| LogP ≤ 5 | 1.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Analyze 2-methylpropane;tungsten with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropane;tungsten?
The IUPAC name of 2-methylpropane;tungsten (CID 144526928) is 2-methylpropane;tungsten.
What is the SMILES notation for 2-methylpropane;tungsten?
The canonical SMILES for 2-methylpropane;tungsten is CC(C)C.[W].
What is the InChIKey of 2-methylpropane;tungsten?
The InChIKey is HQLHPADIHSKCHQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.W/c1-4(2)3;/h4H,1-3H3;.
What are the key properties of 2-methylpropane;tungsten?
2-methylpropane;tungsten has a molecular weight of 241.96 g/mol, XLogP of 1.66, 0 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropane;tungsten is sourced from PubChem (CID 144526928), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).