About formaldehyde;2-methylpropane;propan-2-one
formaldehyde;2-methylpropane;propan-2-one (PubChem CID 157476549) has the molecular formula C9H20O3
and a molecular weight of 176.26 g/mol. Its IUPAC name is formaldehyde;2-methylpropane;propan-2-one.
Molecular Properties
| Compound Name | formaldehyde;2-methylpropane;propan-2-one |
| PubChem CID | 157476549 |
| Molecular Formula | C9H20O3 |
| Molecular Weight | 176.26 g/mol |
| Exact Mass | 176.14 |
| IUPAC Name | formaldehyde;2-methylpropane;propan-2-one |
| SMILES | C=O.C=O.CC(C)=O.CC(C)C |
| InChI | InChI=1S/C4H10.C3H6O.2CH2O/c1-4(2)3;1-3(2)4;2*1-2/h4H,1-3H3;1-2H3;2*1H2 |
| InChIKey | BVQTUGRQISWVRO-UHFFFAOYSA-N |
| XLogP | 1.89 |
| TPSA | 51.21 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.26 |
| LogP ≤ 5 | 1.89 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze formaldehyde;2-methylpropane;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of formaldehyde;2-methylpropane;propan-2-one?
The IUPAC name of formaldehyde;2-methylpropane;propan-2-one (CID 157476549) is formaldehyde;2-methylpropane;propan-2-one.
What is the SMILES notation for formaldehyde;2-methylpropane;propan-2-one?
The canonical SMILES for formaldehyde;2-methylpropane;propan-2-one is C=O.C=O.CC(C)=O.CC(C)C.
What is the InChIKey of formaldehyde;2-methylpropane;propan-2-one?
The InChIKey is BVQTUGRQISWVRO-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H10.C3H6O.2CH2O/c1-4(2)3;1-3(2)4;2*1-2/h4H,1-3H3;1-2H3;2*1H2.
What are the key properties of formaldehyde;2-methylpropane;propan-2-one?
formaldehyde;2-methylpropane;propan-2-one has a molecular weight of 176.26 g/mol, XLogP of 1.89, 0 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for formaldehyde;2-methylpropane;propan-2-one is sourced from PubChem (CID 157476549), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).