About ethene;propan-2-one;titanium
ethene;propan-2-one;titanium (PubChem CID 175481260) has the molecular formula C5H10OTi
and a molecular weight of 134.00 g/mol. Its IUPAC name is ethene;propan-2-one;titanium.
Molecular Properties
| Compound Name | ethene;propan-2-one;titanium |
| PubChem CID | 175481260 |
| Molecular Formula | C5H10OTi |
| Molecular Weight | 134.00 g/mol |
| Exact Mass | 134.02 |
| IUPAC Name | ethene;propan-2-one;titanium |
| SMILES | C=C.CC(C)=O.[Ti] |
| InChI | InChI=1S/C3H6O.C2H4.Ti/c1-3(2)4;1-2;/h1-2H3;1-2H2; |
| InChIKey | NZKPATUVAYRJJQ-UHFFFAOYSA-N |
| XLogP | 1.39 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 134.00 |
| LogP ≤ 5 | 1.39 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|
Analyze ethene;propan-2-one;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethene;propan-2-one;titanium?
The IUPAC name of ethene;propan-2-one;titanium (CID 175481260) is ethene;propan-2-one;titanium.
What is the SMILES notation for ethene;propan-2-one;titanium?
The canonical SMILES for ethene;propan-2-one;titanium is C=C.CC(C)=O.[Ti].
What is the InChIKey of ethene;propan-2-one;titanium?
The InChIKey is NZKPATUVAYRJJQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C2H4.Ti/c1-3(2)4;1-2;/h1-2H3;1-2H2;.
What are the key properties of ethene;propan-2-one;titanium?
ethene;propan-2-one;titanium has a molecular weight of 134.00 g/mol, XLogP of 1.39, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for ethene;propan-2-one;titanium is sourced from PubChem (CID 175481260), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).