About propa-1,2-diene;propan-2-one
propa-1,2-diene;propan-2-one (PubChem CID 159669386) has the molecular formula C6H10O
and a molecular weight of 98.14 g/mol. Its IUPAC name is propa-1,2-diene;propan-2-one.
Molecular Properties
| Compound Name | propa-1,2-diene;propan-2-one |
| PubChem CID | 159669386 |
| Molecular Formula | C6H10O |
| Molecular Weight | 98.14 g/mol |
| Exact Mass | 98.07 |
| IUPAC Name | propa-1,2-diene;propan-2-one |
| SMILES | C=C=C.CC(C)=O |
| InChI | InChI=1S/C3H6O.C3H4/c1-3(2)4;1-3-2/h1-2H3;1-2H2 |
| InChIKey | MTUPPQSKUISNNS-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 98.14 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze propa-1,2-diene;propan-2-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propa-1,2-diene;propan-2-one?
The IUPAC name of propa-1,2-diene;propan-2-one (CID 159669386) is propa-1,2-diene;propan-2-one.
What is the SMILES notation for propa-1,2-diene;propan-2-one?
The canonical SMILES for propa-1,2-diene;propan-2-one is C=C=C.CC(C)=O.
What is the InChIKey of propa-1,2-diene;propan-2-one?
The InChIKey is MTUPPQSKUISNNS-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H6O.C3H4/c1-3(2)4;1-3-2/h1-2H3;1-2H2.
What are the key properties of propa-1,2-diene;propan-2-one?
propa-1,2-diene;propan-2-one has a molecular weight of 98.14 g/mol, XLogP of 1.55, 0 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for propa-1,2-diene;propan-2-one is sourced from PubChem (CID 159669386), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).