About chloromethane;2-methylpropanal
chloromethane;2-methylpropanal (PubChem CID 145351273) has the molecular formula C5H11ClO
and a molecular weight of 122.59 g/mol. Its IUPAC name is chloromethane;2-methylpropanal.
Molecular Properties
| Compound Name | chloromethane;2-methylpropanal |
| PubChem CID | 145351273 |
| Molecular Formula | C5H11ClO |
| Molecular Weight | 122.59 g/mol |
| Exact Mass | 122.05 |
| IUPAC Name | chloromethane;2-methylpropanal |
| SMILES | CC(C)C=O.CCl |
| InChI | InChI=1S/C4H8O.CH3Cl/c1-4(2)3-5;1-2/h3-4H,1-2H3;1H3 |
| InChIKey | SBNNTKVYSMQHDA-UHFFFAOYSA-N |
| XLogP | 1.70 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 122.59 |
| LogP ≤ 5 | 1.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze chloromethane;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of chloromethane;2-methylpropanal?
The IUPAC name of chloromethane;2-methylpropanal (CID 145351273) is chloromethane;2-methylpropanal.
What is the SMILES notation for chloromethane;2-methylpropanal?
The canonical SMILES for chloromethane;2-methylpropanal is CC(C)C=O.CCl.
What is the InChIKey of chloromethane;2-methylpropanal?
The InChIKey is SBNNTKVYSMQHDA-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.CH3Cl/c1-4(2)3-5;1-2/h3-4H,1-2H3;1H3.
What are the key properties of chloromethane;2-methylpropanal?
chloromethane;2-methylpropanal has a molecular weight of 122.59 g/mol, XLogP of 1.70, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for chloromethane;2-methylpropanal is sourced from PubChem (CID 145351273), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).