C5H8Cl3O2- — CID 86737204
propan-2-olate;2,2,2-trichloroacetaldehyde (PubChem CID 86737204) has the molecular formula C5H8Cl3O2- and a molecular weight of 206.48 g/mol. Its IUPAC name is propan-2-olate;2,2,2-trichloroacetaldehyde.
| Compound Name | propan-2-olate;2,2,2-trichloroacetaldehyde |
|---|---|
| PubChem CID | 86737204 |
| Molecular Formula | C5H8Cl3O2- |
| Molecular Weight | 206.48 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | propan-2-olate;2,2,2-trichloroacetaldehyde |
| SMILES | CC(C)[O-].O=CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H7O.C2HCl3O/c1-3(2)4;3-2(4,5)1-6/h3H,1-2H3;1H/q-1; |
| InChIKey | LTSYSRGYLMTZMP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|