About propan-2-olate;2,2,2-trichloroacetaldehyde
propan-2-olate;2,2,2-trichloroacetaldehyde (PubChem CID 86737204) has the molecular formula C5H8Cl3O2-
and a molecular weight of 206.48 g/mol. Its IUPAC name is propan-2-olate;2,2,2-trichloroacetaldehyde.
Molecular Properties
| Compound Name | propan-2-olate;2,2,2-trichloroacetaldehyde |
| PubChem CID | 86737204 |
| Molecular Formula | C5H8Cl3O2- |
| Molecular Weight | 206.48 g/mol |
| Exact Mass | 204.96 |
| IUPAC Name | propan-2-olate;2,2,2-trichloroacetaldehyde |
| SMILES | CC(C)[O-].O=CC(Cl)(Cl)Cl |
| InChI | InChI=1S/C3H7O.C2HCl3O/c1-3(2)4;3-2(4,5)1-6/h3H,1-2H3;1H/q-1; |
| InChIKey | LTSYSRGYLMTZMP-UHFFFAOYSA-N |
| XLogP | 1.31 |
| TPSA | 40.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 206.48 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|
Analyze propan-2-olate;2,2,2-trichloroacetaldehyde with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of propan-2-olate;2,2,2-trichloroacetaldehyde?
The IUPAC name of propan-2-olate;2,2,2-trichloroacetaldehyde (CID 86737204) is propan-2-olate;2,2,2-trichloroacetaldehyde.
What is the SMILES notation for propan-2-olate;2,2,2-trichloroacetaldehyde?
The canonical SMILES for propan-2-olate;2,2,2-trichloroacetaldehyde is CC(C)[O-].O=CC(Cl)(Cl)Cl.
What is the InChIKey of propan-2-olate;2,2,2-trichloroacetaldehyde?
The InChIKey is LTSYSRGYLMTZMP-UHFFFAOYSA-N. The full InChI is InChI=1S/C3H7O.C2HCl3O/c1-3(2)4;3-2(4,5)1-6/h3H,1-2H3;1H/q-1;.
What are the key properties of propan-2-olate;2,2,2-trichloroacetaldehyde?
propan-2-olate;2,2,2-trichloroacetaldehyde has a molecular weight of 206.48 g/mol, XLogP of 1.31, 0 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for propan-2-olate;2,2,2-trichloroacetaldehyde is sourced from PubChem (CID 86737204), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).