About 2-methylpropanal;titanium
2-methylpropanal;titanium (PubChem CID 87093638) has the molecular formula C4H8OTi
and a molecular weight of 119.97 g/mol. Its IUPAC name is 2-methylpropanal;titanium.
Molecular Properties
| Compound Name | 2-methylpropanal;titanium |
| PubChem CID | 87093638 |
| Molecular Formula | C4H8OTi |
| Molecular Weight | 119.97 g/mol |
| Exact Mass | 120.01 |
| IUPAC Name | 2-methylpropanal;titanium |
| SMILES | CC(C)C=O.[Ti] |
| InChI | InChI=1S/C4H8O.Ti/c1-4(2)3-5;/h3-4H,1-2H3; |
| InChIKey | MOKZQYWRIJAWEL-UHFFFAOYSA-N |
| XLogP | 0.84 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 6 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 119.97 |
| LogP ≤ 5 | 0.84 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze 2-methylpropanal;titanium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-methylpropanal;titanium?
The IUPAC name of 2-methylpropanal;titanium (CID 87093638) is 2-methylpropanal;titanium.
What is the SMILES notation for 2-methylpropanal;titanium?
The canonical SMILES for 2-methylpropanal;titanium is CC(C)C=O.[Ti].
What is the InChIKey of 2-methylpropanal;titanium?
The InChIKey is MOKZQYWRIJAWEL-UHFFFAOYSA-N. The full InChI is InChI=1S/C4H8O.Ti/c1-4(2)3-5;/h3-4H,1-2H3;.
What are the key properties of 2-methylpropanal;titanium?
2-methylpropanal;titanium has a molecular weight of 119.97 g/mol, XLogP of 0.84, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-methylpropanal;titanium is sourced from PubChem (CID 87093638), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).