About (2S)-2-fluoropropanal
(2S)-2-fluoropropanal (PubChem CID 98007652) has the molecular formula C3H5FO
and a molecular weight of 76.07 g/mol. Its IUPAC name is (2S)-2-fluoropropanal.
Molecular Properties
| Compound Name | (2S)-2-fluoropropanal |
| PubChem CID | 98007652 |
| Molecular Formula | C3H5FO |
| Molecular Weight | 76.07 g/mol |
| Exact Mass | 76.03 |
| IUPAC Name | (2S)-2-fluoropropanal |
| SMILES | C[C@H](F)C=O |
| InChI | InChI=1S/C3H5FO/c1-3(4)2-5/h2-3H,1H3/t3-/m0/s1 |
| InChIKey | HFURQLWNYUCPHT-VKHMYHEASA-N |
| XLogP | 0.54 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 5 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 76.07 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze (2S)-2-fluoropropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2S)-2-fluoropropanal?
The IUPAC name of (2S)-2-fluoropropanal (CID 98007652) is (2S)-2-fluoropropanal.
What is the SMILES notation for (2S)-2-fluoropropanal?
The canonical SMILES for (2S)-2-fluoropropanal is C[C@H](F)C=O.
What is the InChIKey of (2S)-2-fluoropropanal?
The InChIKey is HFURQLWNYUCPHT-VKHMYHEASA-N. The full InChI is InChI=1S/C3H5FO/c1-3(4)2-5/h2-3H,1H3/t3-/m0/s1.
What are the key properties of (2S)-2-fluoropropanal?
(2S)-2-fluoropropanal has a molecular weight of 76.07 g/mol, XLogP of 0.54, 1 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for (2S)-2-fluoropropanal is sourced from PubChem (CID 98007652), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).