About methane;3-methylbutan-2-ol;2-methylpropanal
methane;3-methylbutan-2-ol;2-methylpropanal (PubChem CID 157103655) has the molecular formula C10H24O2
and a molecular weight of 176.30 g/mol. Its IUPAC name is methane;3-methylbutan-2-ol;2-methylpropanal.
Molecular Properties
| Compound Name | methane;3-methylbutan-2-ol;2-methylpropanal |
| PubChem CID | 157103655 |
| Molecular Formula | C10H24O2 |
| Molecular Weight | 176.30 g/mol |
| Exact Mass | 176.18 |
| IUPAC Name | methane;3-methylbutan-2-ol;2-methylpropanal |
| SMILES | C.CC(C)C(C)O.CC(C)C=O |
| InChI | InChI=1S/C5H12O.C4H8O.CH4/c1-4(2)5(3)6;1-4(2)3-5;/h4-6H,1-3H3;3-4H,1-2H3;1H4 |
| InChIKey | AGBAFNRMMSQSDI-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 37.30 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 176.30 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|
Analyze methane;3-methylbutan-2-ol;2-methylpropanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of methane;3-methylbutan-2-ol;2-methylpropanal?
The IUPAC name of methane;3-methylbutan-2-ol;2-methylpropanal (CID 157103655) is methane;3-methylbutan-2-ol;2-methylpropanal.
What is the SMILES notation for methane;3-methylbutan-2-ol;2-methylpropanal?
The canonical SMILES for methane;3-methylbutan-2-ol;2-methylpropanal is C.CC(C)C(C)O.CC(C)C=O.
What is the InChIKey of methane;3-methylbutan-2-ol;2-methylpropanal?
The InChIKey is AGBAFNRMMSQSDI-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12O.C4H8O.CH4/c1-4(2)5(3)6;1-4(2)3-5;/h4-6H,1-3H3;3-4H,1-2H3;1H4.
What are the key properties of methane;3-methylbutan-2-ol;2-methylpropanal?
methane;3-methylbutan-2-ol;2-methylpropanal has a molecular weight of 176.30 g/mol, XLogP of 2.50, 2 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for methane;3-methylbutan-2-ol;2-methylpropanal is sourced from PubChem (CID 157103655), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).