About 2-sulfanyltridecanal
2-sulfanyltridecanal (PubChem CID 134564742) has the molecular formula C13H26OS
and a molecular weight of 230.42 g/mol. Its IUPAC name is 2-sulfanyltridecanal.
Molecular Properties
| Compound Name | 2-sulfanyltridecanal |
| PubChem CID | 134564742 |
| Molecular Formula | C13H26OS |
| Molecular Weight | 230.42 g/mol |
| Exact Mass | 230.17 |
| IUPAC Name | 2-sulfanyltridecanal |
| SMILES | CCCCCCCCCCCC(S)C=O |
| InChI | InChI=1S/C13H26OS/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14/h12-13,15H,2-11H2,1H3 |
| InChIKey | RHVDFBQSFOEHHJ-UHFFFAOYSA-N |
| XLogP | 4.40 |
| TPSA | 17.07 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 230.42 |
| LogP ≤ 5 | 4.40 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-sulfanyltridecanal with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-sulfanyltridecanal?
The IUPAC name of 2-sulfanyltridecanal (CID 134564742) is 2-sulfanyltridecanal.
What is the SMILES notation for 2-sulfanyltridecanal?
The canonical SMILES for 2-sulfanyltridecanal is CCCCCCCCCCCC(S)C=O.
What is the InChIKey of 2-sulfanyltridecanal?
The InChIKey is RHVDFBQSFOEHHJ-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H26OS/c1-2-3-4-5-6-7-8-9-10-11-13(15)12-14/h12-13,15H,2-11H2,1H3.
What are the key properties of 2-sulfanyltridecanal?
2-sulfanyltridecanal has a molecular weight of 230.42 g/mol, XLogP of 4.40, 11 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-sulfanyltridecanal is sourced from PubChem (CID 134564742), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).