C18H38S2 — CID 98118372
(9S,10S)-octadecane-9,10-dithiol (PubChem CID 98118372) has the molecular formula C18H38S2 and a molecular weight of 318.64 g/mol. Its IUPAC name is (9S,10S)-octadecane-9,10-dithiol.
| Compound Name | (9S,10S)-octadecane-9,10-dithiol |
|---|---|
| PubChem CID | 98118372 |
| Molecular Formula | C18H38S2 |
| Molecular Weight | 318.64 g/mol |
| Exact Mass | 318.24 |
| IUPAC Name | (9S,10S)-octadecane-9,10-dithiol |
| SMILES | CCCCCCCC[C@H](S)[C@@H](S)CCCCCCCC |
| InChI | InChI=1S/C18H38S2/c1-3-5-7-9-11-13-15-17(19)18(20)16-14-12-10-8-6-4-2/h17-20H,3-16H2,1-2H3/t17-,18-/m0/s1 |
| InChIKey | RVAZXJOGBICHED-ROUUACIJSA-N |
| XLogP | 7.08 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 318.64 |
| LogP ≤ 5 | 7.08 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|