About azane;hexane-1,1-dithiol
azane;hexane-1,1-dithiol (PubChem CID 146444544) has the molecular formula C6H17NS2
and a molecular weight of 167.34 g/mol. Its IUPAC name is azane;hexane-1,1-dithiol.
Molecular Properties
| Compound Name | azane;hexane-1,1-dithiol |
| PubChem CID | 146444544 |
| Molecular Formula | C6H17NS2 |
| Molecular Weight | 167.34 g/mol |
| Exact Mass | 167.08 |
| IUPAC Name | azane;hexane-1,1-dithiol |
| SMILES | CCCCCC(S)S.N |
| InChI | InChI=1S/C6H14S2.H3N/c1-2-3-4-5-6(7)8;/h6-8H,2-5H2,1H3;1H3 |
| InChIKey | WGFTUKVGTNRVEW-UHFFFAOYSA-N |
| XLogP | 2.91 |
| TPSA | 35.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 167.34 |
| LogP ≤ 5 | 2.91 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze azane;hexane-1,1-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;hexane-1,1-dithiol?
The IUPAC name of azane;hexane-1,1-dithiol (CID 146444544) is azane;hexane-1,1-dithiol.
What is the SMILES notation for azane;hexane-1,1-dithiol?
The canonical SMILES for azane;hexane-1,1-dithiol is CCCCCC(S)S.N.
What is the InChIKey of azane;hexane-1,1-dithiol?
The InChIKey is WGFTUKVGTNRVEW-UHFFFAOYSA-N. The full InChI is InChI=1S/C6H14S2.H3N/c1-2-3-4-5-6(7)8;/h6-8H,2-5H2,1H3;1H3.
What are the key properties of azane;hexane-1,1-dithiol?
azane;hexane-1,1-dithiol has a molecular weight of 167.34 g/mol, XLogP of 2.91, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for azane;hexane-1,1-dithiol is sourced from PubChem (CID 146444544), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).