C12H26S2 — CID 97050337
(6R,7R)-dodecane-6,7-dithiol (PubChem CID 97050337) has the molecular formula C12H26S2 and a molecular weight of 234.47 g/mol. Its IUPAC name is (6R,7R)-dodecane-6,7-dithiol.
| Compound Name | (6R,7R)-dodecane-6,7-dithiol |
|---|---|
| PubChem CID | 97050337 |
| Molecular Formula | C12H26S2 |
| Molecular Weight | 234.47 g/mol |
| Exact Mass | 234.15 |
| IUPAC Name | (6R,7R)-dodecane-6,7-dithiol |
| SMILES | CCCCC[C@@H](S)[C@H](S)CCCCC |
| InChI | InChI=1S/C12H26S2/c1-3-5-7-9-11(13)12(14)10-8-6-4-2/h11-14H,3-10H2,1-2H3/t11-,12-/m1/s1 |
| InChIKey | CCCFXKAUMZCQEG-VXGBXAGGSA-N |
| XLogP | 4.74 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 234.47 |
| LogP ≤ 5 | 4.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|