About dodecane-6-thiol
dodecane-6-thiol (PubChem CID 18757094) has the molecular formula C12H26S
and a molecular weight of 202.41 g/mol. Its IUPAC name is dodecane-6-thiol.
Molecular Properties
| Compound Name | dodecane-6-thiol |
| PubChem CID | 18757094 |
| Molecular Formula | C12H26S |
| Molecular Weight | 202.41 g/mol |
| Exact Mass | 202.18 |
| IUPAC Name | dodecane-6-thiol |
| SMILES | CCCCCCC(S)CCCCC |
| InChI | InChI=1S/C12H26S/c1-3-5-7-9-11-12(13)10-8-6-4-2/h12-13H,3-11H2,1-2H3 |
| InChIKey | OZZSBTWSDILSDZ-UHFFFAOYSA-N |
| XLogP | 4.84 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.41 |
| LogP ≤ 5 | 4.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze dodecane-6-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecane-6-thiol?
The IUPAC name of dodecane-6-thiol (CID 18757094) is dodecane-6-thiol.
What is the SMILES notation for dodecane-6-thiol?
The canonical SMILES for dodecane-6-thiol is CCCCCCC(S)CCCCC.
What is the InChIKey of dodecane-6-thiol?
The InChIKey is OZZSBTWSDILSDZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H26S/c1-3-5-7-9-11-12(13)10-8-6-4-2/h12-13H,3-11H2,1-2H3.
What are the key properties of dodecane-6-thiol?
dodecane-6-thiol has a molecular weight of 202.41 g/mol, XLogP of 4.84, 9 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for dodecane-6-thiol is sourced from PubChem (CID 18757094), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).