About hexadecane-7-thiol;1-pentylsulfanyldecane
hexadecane-7-thiol;1-pentylsulfanyldecane (PubChem CID 175476465) has the molecular formula C31H66S2
and a molecular weight of 503.00 g/mol. Its IUPAC name is hexadecane-7-thiol;1-pentylsulfanyldecane.
Molecular Properties
| Compound Name | hexadecane-7-thiol;1-pentylsulfanyldecane |
| PubChem CID | 175476465 |
| Molecular Formula | C31H66S2 |
| Molecular Weight | 503.00 g/mol |
| Exact Mass | 502.46 |
| IUPAC Name | hexadecane-7-thiol;1-pentylsulfanyldecane |
| SMILES | CCCCCCCCCC(S)CCCCCC.CCCCCCCCCCSCCCCC |
| InChI | InChI=1S/C16H34S.C15H32S/c1-3-5-7-9-10-11-13-15-16(17)14-12-8-6-4-2;1-3-5-7-8-9-10-11-13-15-16-14-12-6-4-2/h16-17H,3-15H2,1-2H3;3-15H2,1-2H3 |
| InChIKey | GTWIYLVHOTUUOX-UHFFFAOYSA-N |
| XLogP | 12.45 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 26 |
| Heavy Atoms | 33 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 503.00 |
| LogP ≤ 5 | 12.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze hexadecane-7-thiol;1-pentylsulfanyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecane-7-thiol;1-pentylsulfanyldecane?
The IUPAC name of hexadecane-7-thiol;1-pentylsulfanyldecane (CID 175476465) is hexadecane-7-thiol;1-pentylsulfanyldecane.
What is the SMILES notation for hexadecane-7-thiol;1-pentylsulfanyldecane?
The canonical SMILES for hexadecane-7-thiol;1-pentylsulfanyldecane is CCCCCCCCCC(S)CCCCCC.CCCCCCCCCCSCCCCC.
What is the InChIKey of hexadecane-7-thiol;1-pentylsulfanyldecane?
The InChIKey is GTWIYLVHOTUUOX-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34S.C15H32S/c1-3-5-7-9-10-11-13-15-16(17)14-12-8-6-4-2;1-3-5-7-8-9-10-11-13-15-16-14-12-6-4-2/h16-17H,3-15H2,1-2H3;3-15H2,1-2H3.
What are the key properties of hexadecane-7-thiol;1-pentylsulfanyldecane?
hexadecane-7-thiol;1-pentylsulfanyldecane has a molecular weight of 503.00 g/mol, XLogP of 12.45, 26 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecane-7-thiol;1-pentylsulfanyldecane is sourced from PubChem (CID 175476465), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).