About hexadecane-6,7-dithiol
hexadecane-6,7-dithiol (PubChem CID 91163003) has the molecular formula C16H34S2
and a molecular weight of 290.58 g/mol. Its IUPAC name is hexadecane-6,7-dithiol.
Molecular Properties
| Compound Name | hexadecane-6,7-dithiol |
| PubChem CID | 91163003 |
| Molecular Formula | C16H34S2 |
| Molecular Weight | 290.58 g/mol |
| Exact Mass | 290.21 |
| IUPAC Name | hexadecane-6,7-dithiol |
| SMILES | CCCCCCCCCC(S)C(S)CCCCC |
| InChI | InChI=1S/C16H34S2/c1-3-5-7-8-9-10-12-14-16(18)15(17)13-11-6-4-2/h15-18H,3-14H2,1-2H3 |
| InChIKey | VXNJZQONFQYYBR-UHFFFAOYSA-N |
| XLogP | 6.30 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 290.58 |
| LogP ≤ 5 | 6.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze hexadecane-6,7-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of hexadecane-6,7-dithiol?
The IUPAC name of hexadecane-6,7-dithiol (CID 91163003) is hexadecane-6,7-dithiol.
What is the SMILES notation for hexadecane-6,7-dithiol?
The canonical SMILES for hexadecane-6,7-dithiol is CCCCCCCCCC(S)C(S)CCCCC.
What is the InChIKey of hexadecane-6,7-dithiol?
The InChIKey is VXNJZQONFQYYBR-UHFFFAOYSA-N. The full InChI is InChI=1S/C16H34S2/c1-3-5-7-8-9-10-12-14-16(18)15(17)13-11-6-4-2/h15-18H,3-14H2,1-2H3.
What are the key properties of hexadecane-6,7-dithiol?
hexadecane-6,7-dithiol has a molecular weight of 290.58 g/mol, XLogP of 6.30, 13 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for hexadecane-6,7-dithiol is sourced from PubChem (CID 91163003), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).