About dodecan-6-ylphosphane
dodecan-6-ylphosphane (PubChem CID 88935198) has the molecular formula C12H27P
and a molecular weight of 202.32 g/mol. Its IUPAC name is dodecan-6-ylphosphane.
Molecular Properties
| Compound Name | dodecan-6-ylphosphane |
| PubChem CID | 88935198 |
| Molecular Formula | C12H27P |
| Molecular Weight | 202.32 g/mol |
| Exact Mass | 202.19 |
| IUPAC Name | dodecan-6-ylphosphane |
| SMILES | CCCCCCC(P)CCCCC |
| InChI | InChI=1S/C12H27P/c1-3-5-7-9-11-12(13)10-8-6-4-2/h12H,3-11,13H2,1-2H3 |
| InChIKey | QDGKQZJMXFESEQ-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 202.32 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze dodecan-6-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of dodecan-6-ylphosphane?
The IUPAC name of dodecan-6-ylphosphane (CID 88935198) is dodecan-6-ylphosphane.
What is the SMILES notation for dodecan-6-ylphosphane?
The canonical SMILES for dodecan-6-ylphosphane is CCCCCCC(P)CCCCC.
What is the InChIKey of dodecan-6-ylphosphane?
The InChIKey is QDGKQZJMXFESEQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C12H27P/c1-3-5-7-9-11-12(13)10-8-6-4-2/h12H,3-11,13H2,1-2H3.
What are the key properties of dodecan-6-ylphosphane?
dodecan-6-ylphosphane has a molecular weight of 202.32 g/mol, XLogP of 4.78, 9 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for dodecan-6-ylphosphane is sourced from PubChem (CID 88935198), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).