About pentadecan-2-ylphosphane
pentadecan-2-ylphosphane (PubChem CID 154118597) has the molecular formula C15H33P
and a molecular weight of 244.40 g/mol. Its IUPAC name is pentadecan-2-ylphosphane.
Molecular Properties
| Compound Name | pentadecan-2-ylphosphane |
| PubChem CID | 154118597 |
| Molecular Formula | C15H33P |
| Molecular Weight | 244.40 g/mol |
| Exact Mass | 244.23 |
| IUPAC Name | pentadecan-2-ylphosphane |
| SMILES | CCCCCCCCCCCCCC(C)P |
| InChI | InChI=1S/C15H33P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16/h15H,3-14,16H2,1-2H3 |
| InChIKey | UWBZUWHVXOFZFZ-UHFFFAOYSA-N |
| XLogP | 5.95 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 12 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 244.40 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze pentadecan-2-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentadecan-2-ylphosphane?
The IUPAC name of pentadecan-2-ylphosphane (CID 154118597) is pentadecan-2-ylphosphane.
What is the SMILES notation for pentadecan-2-ylphosphane?
The canonical SMILES for pentadecan-2-ylphosphane is CCCCCCCCCCCCCC(C)P.
What is the InChIKey of pentadecan-2-ylphosphane?
The InChIKey is UWBZUWHVXOFZFZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H33P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15(2)16/h15H,3-14,16H2,1-2H3.
What are the key properties of pentadecan-2-ylphosphane?
pentadecan-2-ylphosphane has a molecular weight of 244.40 g/mol, XLogP of 5.95, 12 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for pentadecan-2-ylphosphane is sourced from PubChem (CID 154118597), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).