About decan-2-ylphosphane;thulium
decan-2-ylphosphane;thulium (PubChem CID 87745416) has the molecular formula C10H23PTm
and a molecular weight of 343.20 g/mol. Its IUPAC name is decan-2-ylphosphane;thulium.
Molecular Properties
| Compound Name | decan-2-ylphosphane;thulium |
| PubChem CID | 87745416 |
| Molecular Formula | C10H23PTm |
| Molecular Weight | 343.20 g/mol |
| Exact Mass | 343.09 |
| IUPAC Name | decan-2-ylphosphane;thulium |
| SMILES | CCCCCCCCC(C)P.[Tm] |
| InChI | InChI=1S/C10H23P.Tm/c1-3-4-5-6-7-8-9-10(2)11;/h10H,3-9,11H2,1-2H3; |
| InChIKey | JIVLPRIRHOQSPL-UHFFFAOYSA-N |
| XLogP | 4.00 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 7 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 343.20 |
| LogP ≤ 5 | 4.00 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze decan-2-ylphosphane;thulium with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of decan-2-ylphosphane;thulium?
The IUPAC name of decan-2-ylphosphane;thulium (CID 87745416) is decan-2-ylphosphane;thulium.
What is the SMILES notation for decan-2-ylphosphane;thulium?
The canonical SMILES for decan-2-ylphosphane;thulium is CCCCCCCCC(C)P.[Tm].
What is the InChIKey of decan-2-ylphosphane;thulium?
The InChIKey is JIVLPRIRHOQSPL-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H23P.Tm/c1-3-4-5-6-7-8-9-10(2)11;/h10H,3-9,11H2,1-2H3;.
What are the key properties of decan-2-ylphosphane;thulium?
decan-2-ylphosphane;thulium has a molecular weight of 343.20 g/mol, XLogP of 4.00, 7 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for decan-2-ylphosphane;thulium is sourced from PubChem (CID 87745416), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).