About heptadecan-2-ylphosphane
heptadecan-2-ylphosphane (PubChem CID 154117788) has the molecular formula C17H37P
and a molecular weight of 272.46 g/mol. Its IUPAC name is heptadecan-2-ylphosphane.
Molecular Properties
| Compound Name | heptadecan-2-ylphosphane |
| PubChem CID | 154117788 |
| Molecular Formula | C17H37P |
| Molecular Weight | 272.46 g/mol |
| Exact Mass | 272.26 |
| IUPAC Name | heptadecan-2-ylphosphane |
| SMILES | CCCCCCCCCCCCCCCC(C)P |
| InChI | InChI=1S/C17H37P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18/h17H,3-16,18H2,1-2H3 |
| InChIKey | RZGMAYULAPGFNK-UHFFFAOYSA-N |
| XLogP | 6.73 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 14 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 272.46 |
| LogP ≤ 5 | 6.73 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze heptadecan-2-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of heptadecan-2-ylphosphane?
The IUPAC name of heptadecan-2-ylphosphane (CID 154117788) is heptadecan-2-ylphosphane.
What is the SMILES notation for heptadecan-2-ylphosphane?
The canonical SMILES for heptadecan-2-ylphosphane is CCCCCCCCCCCCCCCC(C)P.
What is the InChIKey of heptadecan-2-ylphosphane?
The InChIKey is RZGMAYULAPGFNK-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H37P/c1-3-4-5-6-7-8-9-10-11-12-13-14-15-16-17(2)18/h17H,3-16,18H2,1-2H3.
What are the key properties of heptadecan-2-ylphosphane?
heptadecan-2-ylphosphane has a molecular weight of 272.46 g/mol, XLogP of 6.73, 14 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for heptadecan-2-ylphosphane is sourced from PubChem (CID 154117788), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).