About nonadecan-10-ylphosphane
nonadecan-10-ylphosphane (PubChem CID 175556620) has the molecular formula C19H41P
and a molecular weight of 300.51 g/mol. Its IUPAC name is nonadecan-10-ylphosphane.
Molecular Properties
| Compound Name | nonadecan-10-ylphosphane |
| PubChem CID | 175556620 |
| Molecular Formula | C19H41P |
| Molecular Weight | 300.51 g/mol |
| Exact Mass | 300.29 |
| IUPAC Name | nonadecan-10-ylphosphane |
| SMILES | CCCCCCCCCC(P)CCCCCCCCC |
| InChI | InChI=1S/C19H41P/c1-3-5-7-9-11-13-15-17-19(20)18-16-14-12-10-8-6-4-2/h19H,3-18,20H2,1-2H3 |
| InChIKey | HHBPZDZWBBFRIG-UHFFFAOYSA-N |
| XLogP | 7.51 |
| TPSA | 0.00 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | |
| Rotatable Bonds | 16 |
| Heavy Atoms | 20 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 300.51 |
| LogP ≤ 5 | 7.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 0 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'phosphor', 'substructure': 'N/A'} |
|---|
Analyze nonadecan-10-ylphosphane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of nonadecan-10-ylphosphane?
The IUPAC name of nonadecan-10-ylphosphane (CID 175556620) is nonadecan-10-ylphosphane.
What is the SMILES notation for nonadecan-10-ylphosphane?
The canonical SMILES for nonadecan-10-ylphosphane is CCCCCCCCCC(P)CCCCCCCCC.
What is the InChIKey of nonadecan-10-ylphosphane?
The InChIKey is HHBPZDZWBBFRIG-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H41P/c1-3-5-7-9-11-13-15-17-19(20)18-16-14-12-10-8-6-4-2/h19H,3-18,20H2,1-2H3.
What are the key properties of nonadecan-10-ylphosphane?
nonadecan-10-ylphosphane has a molecular weight of 300.51 g/mol, XLogP of 7.51, 16 rotatable bonds, 0 hydrogen bond donors, and 0 hydrogen bond acceptors.
Where does this data come from?
All data for nonadecan-10-ylphosphane is sourced from PubChem (CID 175556620), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).