About 1-sulfanylheptan-1-ol
1-sulfanylheptan-1-ol (PubChem CID 10441848) has the molecular formula C7H16OS
and a molecular weight of 148.27 g/mol. Its IUPAC name is 1-sulfanylheptan-1-ol.
Molecular Properties
| Compound Name | 1-sulfanylheptan-1-ol |
| PubChem CID | 10441848 |
| Molecular Formula | C7H16OS |
| Molecular Weight | 148.27 g/mol |
| Exact Mass | 148.09 |
| IUPAC Name | 1-sulfanylheptan-1-ol |
| SMILES | CCCCCCC(O)S |
| InChI | InChI=1S/C7H16OS/c1-2-3-4-5-6-7(8)9/h7-9H,2-6H2,1H3 |
| InChIKey | XBCDECDLTNTPSZ-UHFFFAOYSA-N |
| XLogP | 2.20 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 9 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 148.27 |
| LogP ≤ 5 | 2.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-sulfanylheptan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-sulfanylheptan-1-ol?
The IUPAC name of 1-sulfanylheptan-1-ol (CID 10441848) is 1-sulfanylheptan-1-ol.
What is the SMILES notation for 1-sulfanylheptan-1-ol?
The canonical SMILES for 1-sulfanylheptan-1-ol is CCCCCCC(O)S.
What is the InChIKey of 1-sulfanylheptan-1-ol?
The InChIKey is XBCDECDLTNTPSZ-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H16OS/c1-2-3-4-5-6-7(8)9/h7-9H,2-6H2,1H3.
What are the key properties of 1-sulfanylheptan-1-ol?
1-sulfanylheptan-1-ol has a molecular weight of 148.27 g/mol, XLogP of 2.20, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-sulfanylheptan-1-ol is sourced from PubChem (CID 10441848), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).