About 2-aminotridecane-5-thiol
2-aminotridecane-5-thiol (PubChem CID 90833565) has the molecular formula C13H29NS
and a molecular weight of 231.45 g/mol. Its IUPAC name is 2-aminotridecane-5-thiol.
Molecular Properties
| Compound Name | 2-aminotridecane-5-thiol |
| PubChem CID | 90833565 |
| Molecular Formula | C13H29NS |
| Molecular Weight | 231.45 g/mol |
| Exact Mass | 231.20 |
| IUPAC Name | 2-aminotridecane-5-thiol |
| SMILES | CCCCCCCCC(S)CCC(C)N |
| InChI | InChI=1S/C13H29NS/c1-3-4-5-6-7-8-9-13(15)11-10-12(2)14/h12-13,15H,3-11,14H2,1-2H3 |
| InChIKey | CLLHCZLHUIRVKW-UHFFFAOYSA-N |
| XLogP | 4.16 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 15 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 231.45 |
| LogP ≤ 5 | 4.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 2-aminotridecane-5-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-aminotridecane-5-thiol?
The IUPAC name of 2-aminotridecane-5-thiol (CID 90833565) is 2-aminotridecane-5-thiol.
What is the SMILES notation for 2-aminotridecane-5-thiol?
The canonical SMILES for 2-aminotridecane-5-thiol is CCCCCCCCC(S)CCC(C)N.
What is the InChIKey of 2-aminotridecane-5-thiol?
The InChIKey is CLLHCZLHUIRVKW-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H29NS/c1-3-4-5-6-7-8-9-13(15)11-10-12(2)14/h12-13,15H,3-11,14H2,1-2H3.
What are the key properties of 2-aminotridecane-5-thiol?
2-aminotridecane-5-thiol has a molecular weight of 231.45 g/mol, XLogP of 4.16, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 2-aminotridecane-5-thiol is sourced from PubChem (CID 90833565), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).