About 1-aminoundecane-6-thiol
1-aminoundecane-6-thiol (PubChem CID 175712027) has the molecular formula C11H25NS
and a molecular weight of 203.39 g/mol. Its IUPAC name is 1-aminoundecane-6-thiol.
Molecular Properties
| Compound Name | 1-aminoundecane-6-thiol |
| PubChem CID | 175712027 |
| Molecular Formula | C11H25NS |
| Molecular Weight | 203.39 g/mol |
| Exact Mass | 203.17 |
| IUPAC Name | 1-aminoundecane-6-thiol |
| SMILES | CCCCCC(S)CCCCCN |
| InChI | InChI=1S/C11H25NS/c1-2-3-5-8-11(13)9-6-4-7-10-12/h11,13H,2-10,12H2,1H3 |
| InChIKey | UQNLVGUEFBBCIB-UHFFFAOYSA-N |
| XLogP | 3.38 |
| TPSA | 26.02 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 203.39 |
| LogP ≤ 5 | 3.38 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 1-aminoundecane-6-thiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-aminoundecane-6-thiol?
The IUPAC name of 1-aminoundecane-6-thiol (CID 175712027) is 1-aminoundecane-6-thiol.
What is the SMILES notation for 1-aminoundecane-6-thiol?
The canonical SMILES for 1-aminoundecane-6-thiol is CCCCCC(S)CCCCCN.
What is the InChIKey of 1-aminoundecane-6-thiol?
The InChIKey is UQNLVGUEFBBCIB-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H25NS/c1-2-3-5-8-11(13)9-6-4-7-10-12/h11,13H,2-10,12H2,1H3.
What are the key properties of 1-aminoundecane-6-thiol?
1-aminoundecane-6-thiol has a molecular weight of 203.39 g/mol, XLogP of 3.38, 9 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-aminoundecane-6-thiol is sourced from PubChem (CID 175712027), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).