About azane;5-butyldecane
azane;5-butyldecane (PubChem CID 118324151) has the molecular formula C14H36N2
and a molecular weight of 232.46 g/mol. Its IUPAC name is azane;5-butyldecane.
Molecular Properties
| Compound Name | azane;5-butyldecane |
| PubChem CID | 118324151 |
| Molecular Formula | C14H36N2 |
| Molecular Weight | 232.46 g/mol |
| Exact Mass | 232.29 |
| IUPAC Name | azane;5-butyldecane |
| SMILES | CCCCCC(CCCC)CCCC.N.N |
| InChI | InChI=1S/C14H30.2H3N/c1-4-7-10-13-14(11-8-5-2)12-9-6-3;;/h14H,4-13H2,1-3H3;2*1H3 |
| InChIKey | MQLAQRZWDYBVLN-UHFFFAOYSA-N |
| XLogP | 5.89 |
| TPSA | 70.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 232.46 |
| LogP ≤ 5 | 5.89 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze azane;5-butyldecane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of azane;5-butyldecane?
The IUPAC name of azane;5-butyldecane (CID 118324151) is azane;5-butyldecane.
What is the SMILES notation for azane;5-butyldecane?
The canonical SMILES for azane;5-butyldecane is CCCCCC(CCCC)CCCC.N.N.
What is the InChIKey of azane;5-butyldecane?
The InChIKey is MQLAQRZWDYBVLN-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H30.2H3N/c1-4-7-10-13-14(11-8-5-2)12-9-6-3;;/h14H,4-13H2,1-3H3;2*1H3.
What are the key properties of azane;5-butyldecane?
azane;5-butyldecane has a molecular weight of 232.46 g/mol, XLogP of 5.89, 10 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for azane;5-butyldecane is sourced from PubChem (CID 118324151), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).