About pentane-1,1-dithiol
pentane-1,1-dithiol (PubChem CID 21192276) has the molecular formula C5H12S2
and a molecular weight of 136.28 g/mol. Its IUPAC name is pentane-1,1-dithiol.
Molecular Properties
| Compound Name | pentane-1,1-dithiol |
| PubChem CID | 21192276 |
| Molecular Formula | C5H12S2 |
| Molecular Weight | 136.28 g/mol |
| Exact Mass | 136.04 |
| IUPAC Name | pentane-1,1-dithiol |
| SMILES | CCCCC(S)S |
| InChI | InChI=1S/C5H12S2/c1-2-3-4-5(6)7/h5-7H,2-4H2,1H3 |
| InChIKey | NCHIGRUKPIGGQF-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 136.28 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze pentane-1,1-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of pentane-1,1-dithiol?
The IUPAC name of pentane-1,1-dithiol (CID 21192276) is pentane-1,1-dithiol.
What is the SMILES notation for pentane-1,1-dithiol?
The canonical SMILES for pentane-1,1-dithiol is CCCCC(S)S.
What is the InChIKey of pentane-1,1-dithiol?
The InChIKey is NCHIGRUKPIGGQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H12S2/c1-2-3-4-5(6)7/h5-7H,2-4H2,1H3.
What are the key properties of pentane-1,1-dithiol?
pentane-1,1-dithiol has a molecular weight of 136.28 g/mol, XLogP of 2.36, 3 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for pentane-1,1-dithiol is sourced from PubChem (CID 21192276), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).