C4H10S3 — CID 90930217
butane-1,1,4-trithiol (PubChem CID 90930217) has the molecular formula C4H10S3 and a molecular weight of 154.32 g/mol. Its IUPAC name is butane-1,1,4-trithiol.
| Compound Name | butane-1,1,4-trithiol |
|---|---|
| PubChem CID | 90930217 |
| Molecular Formula | C4H10S3 |
| Molecular Weight | 154.32 g/mol |
| Exact Mass | 153.99 |
| IUPAC Name | butane-1,1,4-trithiol |
| SMILES | SCCCC(S)S |
| InChI | InChI=1S/C4H10S3/c5-3-1-2-4(6)7/h4-7H,1-3H2 |
| InChIKey | HHJIYLFYCBIHJQ-UHFFFAOYSA-N |
| XLogP | 1.88 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 7 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 154.32 |
| LogP ≤ 5 | 1.88 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|