C5H12S3 — CID 87093666
pentane-1,2,5-trithiol (PubChem CID 87093666) has the molecular formula C5H12S3 and a molecular weight of 168.35 g/mol. Its IUPAC name is pentane-1,2,5-trithiol.
| Compound Name | pentane-1,2,5-trithiol |
|---|---|
| PubChem CID | 87093666 |
| Molecular Formula | C5H12S3 |
| Molecular Weight | 168.35 g/mol |
| Exact Mass | 168.01 |
| IUPAC Name | pentane-1,2,5-trithiol |
| SMILES | SCCCC(S)CS |
| InChI | InChI=1S/C5H12S3/c6-3-1-2-5(8)4-7/h5-8H,1-4H2 |
| InChIKey | PCLYNGPHRCACSA-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 168.35 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|