C15H32S7 — CID 175084958
5,9-bis(sulfanylmethyl)tridecane-1,4,7,10,13-pentathiol (PubChem CID 175084958) has the molecular formula C15H32S7 and a molecular weight of 436.89 g/mol. Its IUPAC name is 5,9-bis(sulfanylmethyl)tridecane-1,4,7,10,13-pentathiol.
| Compound Name | 5,9-bis(sulfanylmethyl)tridecane-1,4,7,10,13-pentathiol |
|---|---|
| PubChem CID | 175084958 |
| Molecular Formula | C15H32S7 |
| Molecular Weight | 436.89 g/mol |
| Exact Mass | 436.05 |
| IUPAC Name | 5,9-bis(sulfanylmethyl)tridecane-1,4,7,10,13-pentathiol |
| SMILES | SCCCC(S)C(CS)CC(S)CC(CS)C(S)CCCS |
| InChI | InChI=1S/C15H32S7/c16-5-1-3-14(21)11(9-18)7-13(20)8-12(10-19)15(22)4-2-6-17/h11-22H,1-10H2 |
| InChIKey | XCGKJTVIQURFDD-UHFFFAOYSA-N |
| XLogP | 5.17 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 22 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 436.89 |
| LogP ≤ 5 | 5.17 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|