C20H42S8 — CID 141367683
(7R,12S)-7,12-bis(sulfanylmethyl)octadecane-3,6,9,10,13,16-hexathiol (PubChem CID 141367683) has the molecular formula C20H42S8 and a molecular weight of 539.09 g/mol. Its IUPAC name is (7R,12S)-7,12-bis(sulfanylmethyl)octadecane-3,6,9,10,13,16-hexathiol.
| Compound Name | (7R,12S)-7,12-bis(sulfanylmethyl)octadecane-3,6,9,10,13,16-hexathiol |
|---|---|
| PubChem CID | 141367683 |
| Molecular Formula | C20H42S8 |
| Molecular Weight | 539.09 g/mol |
| Exact Mass | 538.11 |
| IUPAC Name | (7R,12S)-7,12-bis(sulfanylmethyl)octadecane-3,6,9,10,13,16-hexathiol |
| SMILES | CCC(S)CCC(S)[C@H](CS)CC(S)C(S)C[C@H](CS)C(S)CCC(S)CC |
| InChI | InChI=1S/C20H42S8/c1-3-15(23)5-7-17(25)13(11-21)9-19(27)20(28)10-14(12-22)18(26)8-6-16(24)4-2/h13-28H,3-12H2,1-2H3/t13-,14+,15?,16?,17?,18?,19?,20? |
| InChIKey | KIFRJADXIOVSRT-NJVRKQMYSA-N |
| XLogP | 7.03 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 8 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 28 |
| Complexity | — |
3 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 539.09 |
| LogP ≤ 5 | 7.03 |
| H-Bond Donors ≤ 5 | 8 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|