C7H16S3 — CID 175079470
heptane-1,2,4-trithiol (PubChem CID 175079470) has the molecular formula C7H16S3 and a molecular weight of 196.41 g/mol. Its IUPAC name is heptane-1,2,4-trithiol.
| Compound Name | heptane-1,2,4-trithiol |
|---|---|
| PubChem CID | 175079470 |
| Molecular Formula | C7H16S3 |
| Molecular Weight | 196.41 g/mol |
| Exact Mass | 196.04 |
| IUPAC Name | heptane-1,2,4-trithiol |
| SMILES | CCCC(S)CC(S)CS |
| InChI | InChI=1S/C7H16S3/c1-2-3-6(9)4-7(10)5-8/h6-10H,2-5H2,1H3 |
| InChIKey | ZVBJKTVLPUNBKD-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 0.00 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.41 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|