About 4-(methylamino)butane-1,2-dithiol
4-(methylamino)butane-1,2-dithiol (PubChem CID 89300399) has the molecular formula C5H13NS2
and a molecular weight of 151.30 g/mol. Its IUPAC name is 4-(methylamino)butane-1,2-dithiol.
Molecular Properties
| Compound Name | 4-(methylamino)butane-1,2-dithiol |
| PubChem CID | 89300399 |
| Molecular Formula | C5H13NS2 |
| Molecular Weight | 151.30 g/mol |
| Exact Mass | 151.05 |
| IUPAC Name | 4-(methylamino)butane-1,2-dithiol |
| SMILES | CNCCC(S)CS |
| InChI | InChI=1S/C5H13NS2/c1-6-3-2-5(8)4-7/h5-8H,2-4H2,1H3 |
| InChIKey | DRQHESGWPVEZCS-UHFFFAOYSA-N |
| XLogP | 0.82 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 8 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 151.30 |
| LogP ≤ 5 | 0.82 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'thiol_2', 'substructure': 'N/A'} |
|---|
Analyze 4-(methylamino)butane-1,2-dithiol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-(methylamino)butane-1,2-dithiol?
The IUPAC name of 4-(methylamino)butane-1,2-dithiol (CID 89300399) is 4-(methylamino)butane-1,2-dithiol.
What is the SMILES notation for 4-(methylamino)butane-1,2-dithiol?
The canonical SMILES for 4-(methylamino)butane-1,2-dithiol is CNCCC(S)CS.
What is the InChIKey of 4-(methylamino)butane-1,2-dithiol?
The InChIKey is DRQHESGWPVEZCS-UHFFFAOYSA-N. The full InChI is InChI=1S/C5H13NS2/c1-6-3-2-5(8)4-7/h5-8H,2-4H2,1H3.
What are the key properties of 4-(methylamino)butane-1,2-dithiol?
4-(methylamino)butane-1,2-dithiol has a molecular weight of 151.30 g/mol, XLogP of 0.82, 4 rotatable bonds, 3 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-(methylamino)butane-1,2-dithiol is sourced from PubChem (CID 89300399), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).