C11H29N — CID 142089517
N,3-dimethylpentan-1-amine;ethane (PubChem CID 142089517) has the molecular formula C11H29N and a molecular weight of 175.36 g/mol. Its IUPAC name is N,3-dimethylpentan-1-amine;ethane.
| Compound Name | N,3-dimethylpentan-1-amine;ethane |
|---|---|
| PubChem CID | 142089517 |
| Molecular Formula | C11H29N |
| Molecular Weight | 175.36 g/mol |
| Exact Mass | 175.23 |
| IUPAC Name | N,3-dimethylpentan-1-amine;ethane |
| SMILES | CC.CC.CCC(C)CCNC |
| InChI | InChI=1S/C7H17N.2C2H6/c1-4-7(2)5-6-8-3;2*1-2/h7-8H,4-6H2,1-3H3;2*1-2H3 |
| InChIKey | IAJIPDKRPSREOW-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 175.36 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |