C13H29N — CID 171815778
ethane;ethene;3-ethyl-N,4-dimethylpent-4-en-1-amine (PubChem CID 171815778) has the molecular formula C13H29N and a molecular weight of 199.38 g/mol. Its IUPAC name is ethane;ethene;3-ethyl-N,4-dimethylpent-4-en-1-amine.
| Compound Name | ethane;ethene;3-ethyl-N,4-dimethylpent-4-en-1-amine |
|---|---|
| PubChem CID | 171815778 |
| Molecular Formula | C13H29N |
| Molecular Weight | 199.38 g/mol |
| Exact Mass | 199.23 |
| IUPAC Name | ethane;ethene;3-ethyl-N,4-dimethylpent-4-en-1-amine |
| SMILES | C=C.C=C(C)C(CC)CCNC.CC |
| InChI | InChI=1S/C9H19N.C2H6.C2H4/c1-5-9(8(2)3)6-7-10-4;2*1-2/h9-10H,2,5-7H2,1,3-4H3;1-2H3;1-2H2 |
| InChIKey | WTLQADCMMQSZGM-UHFFFAOYSA-N |
| XLogP | 4.03 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 199.38 |
| LogP ≤ 5 | 4.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|