C7H16N2 — CID 142892579
1-N,3-dimethylpent-4-ene-1,4-diamine (PubChem CID 142892579) has the molecular formula C7H16N2 and a molecular weight of 128.22 g/mol. Its IUPAC name is 1-N,3-dimethylpent-4-ene-1,4-diamine.
| Compound Name | 1-N,3-dimethylpent-4-ene-1,4-diamine |
|---|---|
| PubChem CID | 142892579 |
| Molecular Formula | C7H16N2 |
| Molecular Weight | 128.22 g/mol |
| Exact Mass | 128.13 |
| IUPAC Name | 1-N,3-dimethylpent-4-ene-1,4-diamine |
| SMILES | C=C(N)C(C)CCNC |
| InChI | InChI=1S/C7H16N2/c1-6(7(2)8)4-5-9-3/h6,9H,2,4-5,8H2,1,3H3 |
| InChIKey | AABRPUIOLUTBHK-UHFFFAOYSA-N |
| XLogP | 0.70 |
| TPSA | 38.05 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 9 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 128.22 |
| LogP ≤ 5 | 0.70 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |