C6H14ClN — CID 155386259
N,3-dimethylbut-3-en-1-amine;hydrochloride (PubChem CID 155386259) has the molecular formula C6H14ClN and a molecular weight of 135.64 g/mol. Its IUPAC name is N,3-dimethylbut-3-en-1-amine;hydrochloride.
| Compound Name | N,3-dimethylbut-3-en-1-amine;hydrochloride |
|---|---|
| PubChem CID | 155386259 |
| Molecular Formula | C6H14ClN |
| Molecular Weight | 135.64 g/mol |
| Exact Mass | 135.08 |
| IUPAC Name | N,3-dimethylbut-3-en-1-amine;hydrochloride |
| SMILES | C=C(C)CCNC.Cl |
| InChI | InChI=1S/C6H13N.ClH/c1-6(2)4-5-7-3;/h7H,1,4-5H2,2-3H3;1H |
| InChIKey | PSDHTRUNGJOEDZ-UHFFFAOYSA-N |
| XLogP | 1.59 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 8 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 135.64 |
| LogP ≤ 5 | 1.59 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|