C9H15NO — CID 143258823
(3Z)-7-(methylamino)-5-methylidenehepta-1,3-dien-2-ol (PubChem CID 143258823) has the molecular formula C9H15NO and a molecular weight of 153.22 g/mol. Its IUPAC name is (3Z)-7-(methylamino)-5-methylidenehepta-1,3-dien-2-ol.
| Compound Name | (3Z)-7-(methylamino)-5-methylidenehepta-1,3-dien-2-ol |
|---|---|
| PubChem CID | 143258823 |
| Molecular Formula | C9H15NO |
| Molecular Weight | 153.22 g/mol |
| Exact Mass | 153.12 |
| IUPAC Name | (3Z)-7-(methylamino)-5-methylidenehepta-1,3-dien-2-ol |
| SMILES | C=C(O)/C=C\C(=C)CCNC |
| InChI | InChI=1S/C9H15NO/c1-8(6-7-10-3)4-5-9(2)11/h4-5,10-11H,1-2,6-7H2,3H3/b5-4- |
| InChIKey | JKZCKJPJMHTEOJ-PLNGDYQASA-N |
| XLogP | 1.78 |
| TPSA | 32.26 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 11 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 153.22 |
| LogP ≤ 5 | 1.78 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'acyclic_C=C-O', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|